Chapter Notes

Waves

50 min read

INTRODUCTION

Imagine dropping a pebble into a still pond. You see ripples, or disturbances, spreading out in circles. If you place a cork on the water, you'll notice it bobs up and down but doesn't travel outward with the ripples. This tells us something important: it's the disturbance that is moving, not the water itself. This moving disturbance, which transfers energy without transferring matter, is called a wave.

Waves are all around us and are essential for communication. When we speak, we create sound waves in the air. Our ears detect these waves. Modern communication often involves converting one type of wave into another. For example, a sound wave can be turned into an electrical signal, which then generates an electromagnetic wave to be sent via satellite.

Types of Waves

There are three main categories of waves:

  1. Mechanical Waves: These are the most familiar types, like waves on a string, water waves, and sound waves. They need a medium (a substance like a solid, liquid, or gas) to travel through. They work because the particles in the medium are connected by elastic forces, allowing a disturbance to pass from one particle to the next. Mechanical waves cannot travel through a vacuum.

  2. Electromagnetic Waves: These waves, which include light, radio waves, and X-rays, are different because they do not require a medium. They can travel through the vacuum of space. This is how light from distant stars reaches us. In a vacuum, all electromagnetic waves travel at the same incredible speed, known as the speed of light, c, which is c=299,792,458 ms1c=299,792,458 \text{ ms}^{-1}.

  3. Matter Waves: In the realm of quantum mechanics, particles like electrons, protons, and even atoms can behave like waves. These are called matter waves. While they are a more abstract concept, they have practical applications, such as in electron microscopes.

In this chapter, we will focus on mechanical waves.

How Mechanical Waves Work

Mechanical waves are closely related to oscillations. A medium that can support a wave, like a stretched string or the air, is an elastic medium. This means that if you disturb a part of it, restoring forces will try to bring it back to its equilibrium position.

Example
Think of a long train with bogies connected by spring couplings. If the engine gives a push to the first bogie, that push is transmitted down the line from one bogie to the next through the springs. Each bogie just moves back and forth a little, but the push (the disturbance) travels all the way to the end of the train. The whole train doesn't move forward at once; only the disturbance does.

Similarly, a sound wave travels through air by creating regions of compression (where air molecules are packed together) and rarefaction (where they are spread apart). As molecules in a compressed region push on their neighbors, they create a new compression, leaving a rarefaction behind them. This chain reaction allows the sound to travel without any net flow of air.

TRANSVERSE AND LONGITUDINAL WAVES

Mechanical waves can be classified into two types based on how the particles of the medium move relative to the direction of the wave's travel.

Transverse Waves

In a transverse wave, the particles of the medium oscillate perpendicular (at a right angle) to the direction of wave propagation.

Example
Imagine you have a long rope tied to a wall. If you give your end a single flick up and down, you'll see a hump, or a pulse, travel along the rope to the wall. Each piece of the rope only moves up and down, while the wave itself moves horizontally along the rope. This is a transverse wave. If you continuously move your hand up and down in a sinusoidal pattern, you create a continuous transverse wave.

Because transverse waves involve particles sliding past each other, they create a shearing strain in the medium. Therefore, transverse waves can only travel through media that can resist shearing stress, which are primarily solids. They cannot travel through fluids (liquids and gases).

Longitudinal Waves

In a longitudinal wave, the particles of the medium oscillate parallel to (along the same direction as) the direction of wave propagation.

Example
Think of a long pipe filled with air and a piston at one end. If you push the piston forward and pull it back, you create a pulse of high-density air (condensation) followed by a region of low-density air (rarefaction). This pulse travels down the pipe. The air molecules themselves just move back and forth along the length of the pipe, parallel to the direction the wave is moving. Sound waves are the most common example of longitudinal waves.

Longitudinal waves involve compressing and expanding the medium. Since solids, liquids, and gases can all be compressed, longitudinal waves can travel through all elastic media.

Note
Waves on the surface of water are actually a combination of both transverse and longitudinal motion. The water particles move up and down as well as back and forth, creating a complex circular or elliptical motion.

DISPLACEMENT RELATION IN A PROGRESSIVE WAVE

A wave that travels from one point in a medium to another is called a progressive wave or a travelling wave. To describe such a wave mathematically, we need a function that tells us the displacement of any particle at any position x and at any time t.

For a sinusoidal transverse wave travelling in the positive x-direction, this function is: y(x,t)=asin(kxωt+ϕ)y(x, t)=a \sin (k x-\omega t+\phi)

Let's break down the components of this equation:

  • y(x, t) is the displacement of the particle at position x and time t from its equilibrium position.
  • a is the amplitude, which is the maximum displacement of a particle from its equilibrium position. The displacement y can be positive or negative, but the amplitude a is always positive.
  • k is the angular wave number. It relates to how the wave varies with position.
  • ω (omega) is the angular frequency. It relates to how the wave varies with time.
  • (kxωt+ϕk x-\omega t+\phi) is the phase of the wave. It determines the state of oscillation (displacement and velocity) of a particle at a specific position and time.
  • φ (phi) is the initial phase angle or phase constant. It represents the phase of the wave at x=0 and t=0.
Note
If the wave is travelling in the negative x-direction, the equation becomes: y(x,t)=asin(kx+ωt+ϕ)y(x, t)=a \sin (k x+\omega t+\phi) The key difference is the sign between the kx and ωt terms. A minus sign means positive direction, and a plus sign means negative direction.

Wavelength and Angular Wave Number

The wavelength, denoted by λ (lambda), is the minimum spatial distance between two points on a wave that are in the same phase. A simpler way to think about it is the distance between two consecutive crests (peaks) or two consecutive troughs (valleys).

The angular wave number k is related to the wavelength by the formula: k=2πλk=\frac{2 \pi}{\lambda} The SI unit for k is radians per metre (rad m1\text{rad m}^{-1}).

Period, Angular Frequency and Frequency

The period (T) is the time it takes for one particle in the medium to complete one full oscillation.

The angular frequency (ω) is related to the period by: ω=2πT\omega=\frac{2 \pi}{T} Its SI unit is radians per second (rad s1\text{rad s}^{-1}).

The frequency (ν) is the number of complete oscillations a particle makes per second. It is the reciprocal of the period and is measured in hertz (Hz). ν=1T=ω2π\nu=\frac{1}{T}=\frac{\omega}{2 \pi}

For a longitudinal wave, we use the same concepts, but the displacement is often denoted by s(x, t) instead of y(x, t), as the displacement is along the x-axis: s(x,t)=asin(kxωt+ϕ)s(x, t)=a \sin (k x-\omega t+\phi)

Example
A wave travelling along a string is described by, y(x,t)=0.005sin(80.0x3.0t)y(x, t)=0.005 \sin (80.0 x-3.0 t), in which the numerical constants are in SI units (0.005 m,80.0 rad m10.005 \text{ m}, 80.0 \text{ rad m}^{-1}, and 3.0 rad s13.0 \text{ rad s}^{-1}). Calculate (a) the amplitude, (b) the wavelength, and (c) the period and frequency of the wave. Also, calculate the displacement y of the wave at a distance x=30.0 cmx=30.0 \text{ cm} and time t=20 st=20 \text{ s}?

Given

  • Wave equation: y(x,t)=0.005sin(80.0x3.0t)y(x, t)=0.005 \sin (80.0 x-3.0 t)
  • Standard form: y(x,t)=asin(kxωt)y(x, t)=a \sin (k x-\omega t)
  • Position, x=30.0 cm=0.3 mx = 30.0 \text{ cm} = 0.3 \text{ m}
  • Time, t=20 st = 20 \text{ s}

To Find

(a) Amplitude, aa (b) Wavelength, λ\lambda (c) Period, TT, and frequency, ν\nu (d) Displacement, yy, at the given xx and tt

Formula

λ=2πk\lambda = \frac{2\pi}{k} T=2πωT = \frac{2\pi}{\omega} ν=1T\nu = \frac{1}{T}

Solution

By comparing the given equation with the standard form, we can identify the parameters:

  • Amplitude, a=0.005 ma = 0.005 \text{ m}
  • Angular wave number, k=80.0 rad m1k = 80.0 \text{ rad m}^{-1}
  • Angular frequency, ω=3.0 rad s1\omega = 3.0 \text{ rad s}^{-1}

(a) Amplitude

The amplitude of the wave is a=0.005 m=5 mma = 0.005 \text{ m} = 5 \text{ mm}.


(b) Wavelength

We use the relationship between wavelength and angular wave number: λ=2πk=2π80.0 m10.0785 m=7.85 cm\lambda = \frac{2\pi}{k} = \frac{2\pi}{80.0 \text{ m}^{-1}} \approx 0.0785 \text{ m} = 7.85 \text{ cm}


(c) Period and Frequency

First, we find the period from the angular frequency: T=2πω=2π3.0 s12.09 sT = \frac{2\pi}{\omega} = \frac{2\pi}{3.0 \text{ s}^{-1}} \approx 2.09 \text{ s} Next, we find the frequency, which is the inverse of the period: ν=1T=12.09 s0.48 Hz\nu = \frac{1}{T} = \frac{1}{2.09 \text{ s}} \approx 0.48 \text{ Hz}


(d) Displacement at x = 30.0 cm and t = 20 s

We substitute the values of xx and tt into the wave equation: y=(0.005 m)sin(80.0×0.33.0×20)y = (0.005 \text{ m}) \sin (80.0 \times 0.3 - 3.0 \times 20) y=(0.005 m)sin(2460)=(0.005 m)sin(36)y = (0.005 \text{ m}) \sin (24 - 60) = (0.005 \text{ m}) \sin (-36) Here, the argument of the sine function is in radians. y=(0.005 m)sin(36 rad)y = (0.005 \text{ m}) \sin (-36 \text{ rad}) To evaluate this, we can use a calculator. Note that 36 rad1.699 rad-36 \text{ rad} \approx 1.699 \text{ rad} within the principal range after removing multiples of 2π2\pi. y(0.005 m)sin(1.699)(0.005 m)×0.99360.00497 m5 mmy \approx (0.005 \text{ m}) \sin(1.699) \approx (0.005 \text{ m}) \times 0.9936 \approx 0.00497 \text{ m} \approx 5 \text{ mm}

Final Answer (a) The amplitude is 5 mm5 \text{ mm}. (b) The wavelength is 7.85 cm7.85 \text{ cm}. (c) The period is 2.09 s2.09 \text{ s} and the frequency is 0.48 Hz0.48 \text{ Hz}. (d) The displacement at the given point and time is approximately 5 mm5 \text{ mm}.

THE SPEED OF A TRAVELLING WAVE

The speed of a wave is the speed at which the disturbance propagates through the medium. We can determine this by tracking a point of constant phase, like a crest.

The phase of a wave is given by the term (kxωt)(k x-\omega t). For a point of constant phase: kxωt=constantk x-\omega t=\mathrm{constant} If we differentiate this expression with respect to time t, we get: kdxdtω=0k \frac{dx}{dt} - \omega = 0 The term dxdt\frac{dx}{dt} is the speed of the wave, v. So, v=dxdt=ωkv = \frac{dx}{dt}=\frac{\omega}{k}

We can also express the wave speed in terms of wavelength and frequency. Substituting ω=2πν\omega = 2\pi\nu and k=2π/λk = 2\pi/\lambda: v=2πν2π/λ=λνv=\frac{2 \pi \nu}{2 \pi / \lambda}=\lambda \nu This fundamental relationship, v = λν, holds true for all progressive waves. It means the speed of a wave is the product of its wavelength and frequency.

Note
The speed of a mechanical wave is determined by the properties of the medium it travels through (like its elasticity and density), not by the source of the wave. The source determines the frequency (ν). Once the speed (v) is set by the medium, the wavelength (λ) is automatically fixed by the relation λ=v/ν\lambda = v/\nu.

Speed of a Transverse Wave on Stretched String

For a transverse wave on a stretched string, the speed depends on two properties of the medium (the string):

  1. Tension (T): This is the restoring force that pulls the string back to its equilibrium position. A higher tension results in a faster wave.
  2. Linear Mass Density (μ): This is the mass per unit length of the string (μ = m/L). It represents the string's inertia. A heavier (denser) string resists motion more, resulting in a slower wave.

The formula for the speed of a transverse wave on a string is: v=Tμv=\sqrt{\frac{T}{\mu}}

Example
A steel wire 0.72 m long has a mass of 5.0×103 kg5.0 \times 10^{-3} \text{ kg}. If the wire is under a tension of 60 N, what is the speed of transverse waves on the wire?

Given

  • Length of wire, L=0.72 mL = 0.72 \text{ m}
  • Mass of wire, m=5.0×103 kgm = 5.0 \times 10^{-3} \text{ kg}
  • Tension, T=60 NT = 60 \text{ N}

To Find

Speed of the wave, vv

Formula

First, find the linear mass density: μ=mL\mu = \frac{m}{L} Then, use the speed formula: v=Tμv=\sqrt{\frac{T}{\mu}}

Solution

  1. Calculate the linear mass density: μ=5.0×103 kg0.72 m=6.9×103 kg m1\mu = \frac{5.0 \times 10^{-3} \text{ kg}}{0.72 \text{ m}} = 6.9 \times 10^{-3} \text{ kg m}^{-1}

  2. Calculate the speed of the wave: v=60 N6.9×103 kg m18695.6593 m s1v=\sqrt{\frac{60 \text{ N}}{6.9 \times 10^{-3} \text{ kg m}^{-1}}} \approx \sqrt{8695.65} \approx 93 \text{ m s}^{-1}

Final Answer The speed of transverse waves on the wire is approximately 93 m s193 \text{ m s}^{-1}.

Speed of a Longitudinal Wave (Speed of Sound)

For a longitudinal wave, like sound, the speed depends on the medium's elastic properties and its density.

  1. Elastic Modulus: This measures the medium's resistance to being deformed. For fluids (liquids and gases), this is the Bulk Modulus (B). For solids, it is often the Young's Modulus (Y). A higher modulus means the medium is "stiffer" and waves travel faster.
  2. Density (ρ): This is the mass per unit volume. It represents the medium's inertia. Higher density leads to slower waves.

The general formula for the speed of a longitudinal wave is: v=Bρ(for fluids)v=\sqrt{\frac{B}{\rho}} \quad \text{(for fluids)} v=Yρ(for a solid bar)v=\sqrt{\frac{Y}{\rho}} \quad \text{(for a solid bar)}

Generally, sound travels fastest in solids, then liquids, and slowest in gases. This is because solids and liquids are much harder to compress (have a much higher elastic modulus) than gases, and this effect outweighs their higher density.

Speed of Sound in a Gas: Newton's Formula and Laplace's Correction

Isaac Newton first derived a formula for the speed of sound in a gas. He assumed that the compressions and rarefactions caused by a sound wave happen so slowly that the temperature of the gas remains constant (an isothermal process). Under this assumption, the bulk modulus B is equal to the pressure P. This gives Newton's formula: v=Pρv=\sqrt{\frac{P}{\rho}}

However, this formula gives a value for the speed of sound in air at Standard Temperature and Pressure (STP) of about 280 m s1280 \text{ m s}^{-1}, which is about 15% lower than the measured value of 331 m s1331 \text{ m s}^{-1}.

Pierre-Simon Laplace corrected this by pointing out that the compressions and rarefactions happen too quickly for heat to be exchanged with the surroundings. This means the process is adiabatic, not isothermal. For an adiabatic process, the bulk modulus is B=γPB = \gamma P, where γ (gamma) is the ratio of specific heats (Cp/CvC_p/C_v).

This leads to the Laplace correction, which is the correct formula for the speed of sound in a gas: v=γPρv=\sqrt{\frac{\gamma P}{\rho}} For air, γ1.4\gamma \approx 1.4 (or 7/5), and using this value gives a calculated speed of sound that agrees very well with experimental results.

Example
Estimate the speed of sound in air at standard temperature and pressure. The mass of 1 mole of air is 29.0×103 kg29.0 \times 10^{-3} \text{ kg}.

Given

  • 1 mole of any gas occupies 22.4 litres (22.4×103 m322.4 \times 10^{-3} \text{ m}^3) at STP.
  • Mass of 1 mole of air, M=29.0×103 kgM = 29.0 \times 10^{-3} \text{ kg}.
  • Standard pressure, P=1.01×105 N m2P = 1.01 \times 10^{5} \text{ N m}^{-2}.
  • Using Newton's formula.

To Find

The speed of sound in air at STP, vv.

Formula

First, find the density of air at STP: ρo=mass of one molevolume of one mole at STP\rho_{o} = \frac{\text{mass of one mole}}{\text{volume of one mole at STP}} Then, use Newton's formula: v=Pρov=\sqrt{\frac{P}{\rho_{o}}}

Solution

  1. Calculate the density of air: ρo=29.0×103 kg22.4×103 m3=1.29 kg m3\rho_{o} = \frac{29.0 \times 10^{-3} \text{ kg}}{22.4 \times 10^{-3} \text{ m}^{3}} = 1.29 \text{ kg m}^{-3}

  2. Calculate the speed of sound using Newton's formula: v=1.01×105 N m21.29 kg m378294280 m s1v=\sqrt{\frac{1.01 \times 10^{5} \text{ N m}^{-2}}{1.29 \text{ kg m}^{-3}}} \approx \sqrt{78294} \approx 280 \text{ m s}^{-1}

Final Answer Using Newton's formula, the estimated speed of sound in air at STP is 280 m s1280 \text{ m s}^{-1}. (As noted above, this is incorrect, and the Laplace correction is needed for an accurate value.)

THE PRINCIPLE OF SUPERPOSITION OF WAVES

What happens when two or more waves travel through the same medium at the same time? The principle of superposition states that the net displacement of any particle in the medium is the algebraic sum of the displacements that would have been caused by each wave individually.

Mathematically, if two waves produce displacements y1(x,t)y_1(x, t) and y2(x,t)y_2(x, t), the resultant displacement y(x,t)y(x, t) is: y(x,t)=y1(x,t)+y2(x,t)y(x, t)=y_{1}(x, t)+y_{2}(x, t)

Essentially, the waves pass through each other without being permanently altered. While they overlap, they combine to create a new wave shape.

Interference of Waves

When two harmonic waves with the same frequency and wavelength overlap, they create a phenomenon called interference.

Consider two waves travelling in the same direction with equal amplitude a but with a phase difference of φ: y1(x,t)=asin(kxωt)y_{1}(x, t)=a \sin (k x-\omega t) y2(x,t)=asin(kxωt+ϕ)y_{2}(x, t)=a \sin (k x-\omega t+\phi)

According to the principle of superposition, the resultant wave is: y(x,t)=y1+y2=2acosϕ2sin(kxωt+ϕ2)y(x, t) = y_1 + y_2 = 2 a \cos \frac{\phi}{2} \sin \left(k x-\omega t+\frac{\phi}{2}\right)

The resultant wave is also a harmonic wave with the same frequency and wavelength. However, its amplitude, A=2acos(ϕ/2)A = 2 a \cos(\phi/2), depends on the phase difference φ.

  • Constructive Interference: When the waves are in phase (ϕ=0,2π,4π,...\phi = 0, 2\pi, 4\pi, ...), the cosine term is 1. The resultant amplitude is A=2aA = 2a, the maximum possible. The crests of one wave align with the crests of the other, reinforcing each other.
  • Destructive Interference: When the waves are out of phase (ϕ=π,3π,5π,...\phi = \pi, 3\pi, 5\pi, ...), the cosine term is 0. The resultant amplitude is A=0A = 0. The crests of one wave align with the troughs of the other, completely canceling each other out.

REFLECTION OF WAVES

When a wave encounters a boundary, it can be reflected. The nature of the reflection depends on the type of boundary.

Reflection at a Rigid Boundary

A rigid boundary is one that cannot move, like a string tied firmly to a wall. When a wave pulse reaches a rigid boundary, it gets reflected. The reflected wave has the same shape as the incident (incoming) wave but is inverted.

This inversion corresponds to a phase change of π radians (or 180°).

Why does this happen? At the rigid wall, the displacement must always be zero. By the principle of superposition, the only way for the incident pulse and reflected pulse to add up to zero at the wall is if the reflected pulse is an inverted version of the incident one.

If the incident wave is yi(x,t)=asin(kxωt)y_{i}(x, t)=a \sin (k x-\omega t), the reflected wave will be: yr(x,t)=asin(kx+ωt+π)=asin(kx+ωt)y_{r}(x, t) = a \sin (k x+\omega t+\pi) = -a \sin (k x+\omega t)

Reflection at an Open Boundary

An open boundary (or free end) is one that is free to move, like a string tied to a light ring that can slide frictionlessly up and down a rod.

When a wave pulse reaches an open boundary, it is reflected without any inversion. There is no phase change upon reflection.

The reflected wave has the same phase as the incident wave. If the incident wave is yi(x,t)=asin(kxωt)y_{i}(x, t)=a \sin (k x-\omega t), the reflected wave will be: yr(x,t)=asin(kx+ωt)y_{r}(x, t) = a \sin (k x+\omega t)

STANDING WAVES AND NORMAL MODES

When a wave in a bounded medium (like a string fixed at both ends) reflects off a boundary, the reflected wave travels back and interferes with the original incident waves. The superposition of two identical waves travelling in opposite directions creates a special pattern called a standing wave or stationary wave.

Consider two waves with the same amplitude, frequency, and wavelength travelling in opposite directions: y1(x,t)=asin(kxωt)y_{1}(x, t)=a \sin (k x-\omega t) y2(x,t)=asin(kx+ωt)y_{2}(x, t)=a \sin (k x+\omega t)

The resultant wave is: y(x,t)=y1+y2=[2asinkx]cosωty(x, t) = y_1 + y_2 = [2 a \sin k x] \cos \omega t

Unlike a travelling wave, this wave pattern does not move left or right. Each particle simply oscillates up and down with an amplitude that depends on its position x.

Nodes and Antinodes

In a standing wave, there are specific points with distinct characteristics:

  • Nodes: These are points where the amplitude is always zero (2asinkx=02a \sin kx = 0). The particles at these locations do not move at all. Nodes occur where sinkx=0\sin kx = 0, which means kx=nπkx = n\pi for n=0,1,2,...n = 0, 1, 2, .... The distance between two successive nodes is λ/2\lambda/2.
  • Antinodes: These are points where the amplitude is maximum (2a2a). The particles at these locations oscillate with the largest possible amplitude. Antinodes occur where sinkx=1|\sin kx| = 1, which means kx=(n+1/2)πkx = (n+1/2)\pi for n=0,1,2,...n = 0, 1, 2, .... The distance between two successive antinodes is also λ/2\lambda/2.

Normal Modes of a Stretched String

For a string of length L fixed at both ends, the ends must be nodes. This boundary condition restricts the possible wavelengths and frequencies that can form standing waves on the string.

The condition for the end at x=Lx=L to be a node is: L=nλ2for n=1,2,3,...L = n \frac{\lambda}{2} \quad \text{for } n=1, 2, 3, ...

This means only specific wavelengths are allowed: λn=2Ln\lambda_n=\frac{2 L}{n}

The corresponding allowed frequencies, called natural frequencies or normal modes, are given by vn=v/λnv_n = v/\lambda_n: vn=nv2L,for n=1,2,3,...v_n=\frac{n v}{2 L}, \quad \text{for } n=1, 2, 3, ...

  • n = 1: Fundamental Frequency or First Harmonic. This is the lowest possible frequency of vibration. v1=v/2Lv_1 = v/2L.
  • n = 2: Second Harmonic (or first overtone). v2=2(v/2L)=2v1v_2 = 2(v/2L) = 2v_1.
  • n = 3: Third Harmonic (or second overtone). v3=3(v/2L)=3v1v_3 = 3(v/2L) = 3v_1.

A vibrating string, like on a guitar or violin, typically vibrates as a superposition of many of these harmonics, which gives the instrument its unique sound or timbre.

Normal Modes of an Air Column

Standing waves can also be set up in air columns, like in organ pipes or flutes.

Pipe Closed at One End

For a pipe of length L that is closed at one end and open at the other:

  • The closed end must be a displacement node.
  • The open end is a displacement antinode.

This boundary condition requires that the length of the pipe be an odd multiple of a quarter-wavelength: L=(n+12)λ2for n=0,1,2,...L = (n+\frac{1}{2}) \frac{\lambda}{2} \quad \text{for } n=0, 1, 2, ... The allowed frequencies are: vn=(n+12)v2L=(2n+1)v4Lv_n = (n+\frac{1}{2}) \frac{v}{2 L} = (2n+1) \frac{v}{4 L}

  • n = 0: Fundamental Frequency (First Harmonic): v1=v/4Lv_1 = v/4L.
  • n = 1: Third Harmonic: v3=3(v/4L)=3v1v_3 = 3(v/4L) = 3v_1.
  • n = 2: Fifth Harmonic: v5=5(v/4L)=5v1v_5 = 5(v/4L) = 5v_1.
Note
A pipe closed at one end can only produce odd harmonics.

Pipe Open at Both Ends

For a pipe of length L that is open at both ends, both ends must be displacement antinodes. This leads to the same frequency formula as a string fixed at both ends: vn=nv2L,for n=1,2,3,...v_n=\frac{n v}{2 L}, \quad \text{for } n=1, 2, 3, ... An open pipe can produce all harmonics (both even and odd).

Example
A pipe, 30.0 cm long, is open at both ends. Which harmonic mode of the pipe resonates a 1.1 kHz source? Will resonance with the same source be observed if one end of the pipe is closed? Take the speed of sound in air as 330 m s1330 \text{ m s}^{-1}.

Given

  • Length of pipe, L=30.0 cm=0.3 mL = 30.0 \text{ cm} = 0.3 \text{ m}
  • Speed of sound, v=330 m s1v = 330 \text{ m s}^{-1}
  • Source frequency, fsource=1.1 kHz=1100 Hzf_{source} = 1.1 \text{ kHz} = 1100 \text{ Hz}

To Find

(i) Which harmonic mode resonates when the pipe is open at both ends. (ii) Whether resonance will occur if one end is closed.

Formula

For an open pipe: vn=nv2L,for n=1,2,3,...v_n = \frac{nv}{2L}, \quad \text{for } n=1, 2, 3, ... For a closed pipe: vn=(2n+1)v4L,for n=0,1,2,...v_n = (2n+1)\frac{v}{4L}, \quad \text{for } n=0, 1, 2, ...

Solution

(i) Pipe open at both ends

The possible harmonic frequencies for the open pipe are: vn=n×330 m s12×0.3 m=n×3300.6=550n Hzv_n = \frac{n \times 330 \text{ m s}^{-1}}{2 \times 0.3 \text{ m}} = \frac{n \times 330}{0.6} = 550n \text{ Hz} We need to find an integer n for which vn=1100 Hzv_n = 1100 \text{ Hz}. 1100=550n1100 = 550n n=1100550=2n = \frac{1100}{550} = 2 Since n=2 is an integer, resonance occurs. This corresponds to the second harmonic.


(ii) Pipe closed at one end

The possible harmonic frequencies for the closed pipe are odd harmonics. The fundamental frequency is: v1=v4L=330 m s14×0.3 m=3301.2=275 Hzv_1 = \frac{v}{4L} = \frac{330 \text{ m s}^{-1}}{4 \times 0.3 \text{ m}} = \frac{330}{1.2} = 275 \text{ Hz} The other possible frequencies are odd multiples of this:

  • v3=3×275=825 Hzv_3 = 3 \times 275 = 825 \text{ Hz}
  • v5=5×275=1375 Hzv_5 = 5 \times 275 = 1375 \text{ Hz} The source frequency of 1100 Hz1100 \text{ Hz} is not one of the natural frequencies of the closed pipe (1100/275=41100 / 275 = 4, which is an even multiple). Therefore, no resonance will be observed if one end of the pipe is closed.

BEATS

When two sound waves of slightly different frequencies are superposed, the intensity of the resulting sound is not constant. Instead, it varies periodically, creating a "waxing and waning" effect known as beats.

This phenomenon arises from the continuous cycling between constructive and destructive interference.

Consider two sound waves of equal amplitude a and slightly different angular frequencies ω1\omega_1 and ω2\omega_2: s1=acosω1ts_{1}=a \cos \omega_{1} t s2=acosω2ts_{2}=a \cos \omega_{2} t

The resultant wave is: s=s1+s2=[2acosωbt]cosωats = s_1 + s_2 = \left[2 a \cos \omega_{b} t\right] \cos \omega_{a} t where:

  • ωa=(ω1+ω2)2\omega_{a}=\frac{(\omega_{1}+\omega_{2})}{2} is the average angular frequency.
  • ωb=(ω1ω2)2\omega_{b}=\frac{(\omega_{1}-\omega_{2})}{2} is related to the beat frequency.

The resultant sound wave oscillates with the average frequency ωa\omega_a, but its amplitude, [2acosωbt][2 a \cos \omega_{b} t], varies slowly over time. The intensity is maximum when cosωbt=±1\cos \omega_b t = \pm 1. This happens twice in each cycle of the cosine function. Therefore, the frequency at which the loudness waxes and wanes (the beat frequency) is 2ωb=ω1ω22\omega_b = \omega_1 - \omega_2.

In terms of frequency ν (where ω=2πν\omega = 2\pi\nu), the beat frequency is simply the difference between the two source frequencies: vbeat=v1v2v_{\text{beat}} = |v_{1}-v_{2}|

Musicians use beats to tune their instruments. By listening for the beat frequency between their instrument and a reference note, they can adjust the tension until the beats disappear (vbeat=0v_{beat} = 0), indicating the frequencies are identical.

Example
Two sitar strings A and B playing the note 'Dha' are slightly out of tune and produce beats of frequency 5 Hz. The tension of the string B is slightly increased and the beat frequency is found to decrease to 3 Hz. What is the original frequency of B if the frequency of A is 427 Hz?

Given

  • Frequency of string A, vA=427 Hzv_A = 427 \text{ Hz}
  • Initial beat frequency, vbeat,1=5 Hzv_{beat,1} = 5 \text{ Hz}
  • Tension in string B is increased.
  • Final beat frequency, vbeat,2=3 Hzv_{beat,2} = 3 \text{ Hz}

To Find

The original frequency of string B, vBv_B.

Formula

vbeat=vAvBv_{beat} = |v_A - v_B| Frequency of a string is related to tension by vTv \propto \sqrt{T}.

Solution

Initially, the beat frequency is 5 Hz. This means the frequency of B is either:

  • Case 1: vB=vA+5=427+5=432 Hzv_B = v_A + 5 = 427 + 5 = 432 \text{ Hz}
  • Case 2: vB=vA5=4275=422 Hzv_B = v_A - 5 = 427 - 5 = 422 \text{ Hz}

Now, the tension in string B is increased. Increasing the tension increases the frequency of the string (vTv \propto \sqrt{T}). Let the new frequency of B be vBv_B'. So, vB>vBv_B' > v_B.

Let's analyze both cases:

  • If Case 1 were true (original vB=432 Hzv_B = 432 \text{ Hz}): Increasing the tension would make vBv_B' even higher (e.g., 433 Hz). The new beat frequency would be 427vB|427 - v_B'|, which would be greater than 5 Hz. This contradicts the observation that the beat frequency decreased to 3 Hz.

  • If Case 2 were true (original vB=422 Hzv_B = 422 \text{ Hz}): Increasing the tension would make vBv_B' higher than 422 Hz (e.g., 424 Hz). The new beat frequency would be 427vB|427 - v_B'|. As vBv_B' increases from 422 Hz towards 427 Hz, the difference 427vB|427 - v_B'| decreases. For example, if the new frequency is 424 Hz, the new beat frequency is 427424=3 Hz|427-424| = 3 \text{ Hz}. This matches the observation.

Therefore, the original frequency of B must have been less than the frequency of A.

Final Answer The original frequency of B is 422 Hz422 \text{ Hz}.

Introduction to Waves

A wave is a disturbance that travels through a medium or space, transferring energy from one point to another without the physical transfer of matter. When you drop a pebble into a still pond, you see circular ripples spread out. A cork placed on the water will bob up and down but won't travel outward with the ripples. This shows that it's the disturbance, not the water itself, that is moving.

Waves are fundamental to our world. They are how we communicate, see, and hear.

  • Speech and Hearing: Sound waves travel through the air from a speaker to a listener.
  • Communication: Signals are transmitted through various types of waves, such as sound waves, electrical signals, and electromagnetic waves (like radio waves used by satellites).

There are three main categories of waves:

  1. Mechanical Waves: These waves, like sound waves, water waves, and waves on a string, require a material medium (solid, liquid, or gas) to travel. They rely on the elastic properties of the medium, where particles oscillate and transfer energy to their neighbors. This chapter focuses on mechanical waves.
  2. Electromagnetic Waves: These waves, including light, radio waves, and X-rays, do not require a medium and can travel through a vacuum. In a vacuum, all electromagnetic waves travel at the same speed, the speed of light, c=299,792,458 m s1c = 299,792,458 \text{ m s}^{-1}.
  3. Matter Waves: In quantum mechanics, particles like electrons, protons, and atoms are associated with waves. These matter waves are essential to technologies like the electron microscope.

The study of waves is built on the principles of oscillations. In an elastic medium like a stretched string or air, particles are bound by forces. When one particle is disturbed, it oscillates and passes that disturbance along to the next particle, creating a propagating wave.

Example
Imagine a long train with carriages connected by spring couplings. If the engine gives a sudden push to the first carriage, the push travels down the entire train from one carriage to the next. The whole train doesn't move at once; rather, a disturbance (a compression of the springs) propagates along its length. Each carriage just moves a little back and forth. This is similar to how a longitudinal wave travels.

Transverse and Longitudinal Waves

Mechanical waves are classified based on the direction of particle oscillation relative to the direction of wave propagation.

Transverse Waves

In a transverse wave, the particles of the medium oscillate perpendicular (at a right angle) to the direction the wave is travelling.

Example
If you give one end of a stretched rope a quick up-and-down jerk, a pulse travels along the rope. The rope itself moves up and down, while the wave travels horizontally. This is a transverse wave. Light waves are also transverse waves.
  • Key Feature: Transverse waves involve a shearing strain, where layers of the medium slide past each other. Because of this, they can only travel through media that can resist shearing forces, such as solids. They cannot propagate through fluids (liquids and gases).

Longitudinal Waves

In a longitudinal wave, the particles of the medium oscillate back and forth along the same direction that the wave is travelling.

Example
Sound waves are the most common example of longitudinal waves. When a sound is made, it causes air particles to be pushed together (compressions) and then spread apart (rarefactions). This pattern of compressions and rarefactions travels through the air to our ears.
  • Key Feature: Longitudinal waves involve compressive strain, changing the volume and density of the medium. Since solids, liquids, and gases can all be compressed, longitudinal waves can travel through all elastic media.

Combination Waves

Some waves are a mix of both transverse and longitudinal motion. For instance, the particles in an ocean wave move not just up and down but also back and forth, tracing a circular or elliptical path.

Example
Given below are some examples of wave motion. State in each case if the wave motion is transverse, longitudinal or a combination of both: (a) Motion of a kink in a longitudinal spring produced by displacing one end of the spring sideways. (b) Waves produced in a cylinder containing a liquid by moving its piston back and forth. (c) Waves produced by a motorboat sailing in water. (d) Ultrasonic waves in air produced by a vibrating quartz crystal.

Answer

(a) Transverse and longitudinal: The sideways displacement creates a transverse wave, but the compression/stretching nature of the spring also allows for longitudinal motion. (b) Longitudinal: Pushing a piston back and forth in a liquid creates compressions and rarefactions, which is a longitudinal wave. (c) Transverse and longitudinal: Water waves created by a boat are a combination of both types of motion. (d) Longitudinal: Ultrasonic waves are sound waves (though at a frequency humans can't hear), and all sound waves in air are longitudinal.

Displacement Relation in a Progressive Wave

A progressive wave (or travelling wave) is a wave that moves from one point to another. To describe it mathematically, we need an equation that shows the displacement of any particle in the medium at any given time.

For a sinusoidal wave travelling along the x-axis, the displacement y at position x and time t is given by the equation: y(x,t)=asin(kxωt+ϕ)y(x, t) = a \sin(kx - \omega t + \phi)

Let's break down the components of this equation:

  • y(x,t)y(x, t): The displacement of the particle from its equilibrium position.
  • aa: The amplitude, which is the maximum displacement of a particle. The displacement y can be positive or negative, but the amplitude a is always positive.
  • (kxωt+ϕ)(kx - \omega t + \phi): The phase of the wave. The phase determines the state of oscillation (displacement and velocity) of a particle at a specific position and time.
  • ϕ\phi: The initial phase angle (or phase constant). It represents the phase of the wave at the origin (x=0x=0) at the start time (t=0t=0).
  • kk: The angular wave number (or propagation constant).
  • ω\omega: The angular frequency.
Note
The sign in the phase determines the direction of travel.
  • (kxωt)(kx - \omega t) represents a wave travelling in the positive x-direction.
  • (kx+ωt)(kx + \omega t) represents a wave travelling in the negative x-direction.

Wavelength and Angular Wave Number

The wavelength (λ\lambda) is the minimum distance between two points on a wave that are in the same phase. For example, it's the distance from one crest to the next, or one trough to the next.

The angular wave number, kk, is related to the wavelength by the formula: k=2πλk = \frac{2\pi}{\lambda} The SI unit for kk is radians per metre (rad m1\text{rad m}^{-1}).

Period, Angular Frequency, and Frequency

  • The period (T) is the time it takes for one particle in the medium to complete one full oscillation.
  • The angular frequency (ω\omega) is related to the period by: ω=2πT\omega = \frac{2\pi}{T} Its SI unit is radians per second (rad s1\text{rad s}^{-1}).
  • The frequency (ν\nu) is the number of complete oscillations per second. It is the reciprocal of the period and is related to the angular frequency by: ν=1T=ω2π\nu = \frac{1}{T} = \frac{\omega}{2\pi} Frequency is measured in hertz (Hz).

For a longitudinal wave, the same principles apply, but the displacement is typically denoted by s instead of y: s(x,t)=asin(kxωt+ϕ)s(x, t) = a \sin(kx - \omega t + \phi)

Example
A wave travelling along a string is described by, y(x,t)=0.005sin(80.0x3.0t)y(x, t) = 0.005 \sin(80.0x - 3.0t), in which the numerical constants are in SI units (0.005 m,80.0 rad m10.005 \text{ m}, 80.0 \text{ rad m}^{-1}, and 3.0 rad s13.0 \text{ rad s}^{-1}). Calculate (a) the amplitude, (b) the wavelength, and (c) the period and frequency of the wave. Also, calculate the displacement y of the wave at a distance x=30.0 cmx = 30.0 \text{ cm} and time t=20 st = 20 \text{ s}?

Given

  • Wave equation: y(x,t)=0.005sin(80.0x3.0t)y(x, t) = 0.005 \sin(80.0x - 3.0t)
  • Position, x=30.0 cm=0.3 mx = 30.0 \text{ cm} = 0.3 \text{ m}
  • Time, t=20 st = 20 \text{ s}

To Find

(a) Amplitude, aa (b) Wavelength, λ\lambda (c) Period, TT, and frequency, ν\nu (d) Displacement, yy, at the given xx and tt

Formula

Standard wave equation: y(x,t)=asin(kxωt)y(x, t) = a \sin(kx - \omega t) Wavelength: λ=2π/k\lambda = 2\pi / k Period: T=2π/ωT = 2\pi / \omega Frequency: ν=1/T\nu = 1/T

Solution

By comparing the given equation with the standard form, we can identify the parameters:

  • a=0.005 ma = 0.005 \text{ m}
  • k=80.0 rad m1k = 80.0 \text{ rad m}^{-1}
  • ω=3.0 rad s1\omega = 3.0 \text{ rad s}^{-1}

(a) Amplitude The amplitude of the wave is a=0.005 ma = 0.005 \text{ m}, which is equal to 5 mm5 \text{ mm}.


(b) Wavelength Using the relation between wavelength and angular wave number: λ=2πk=2π80.0 m10.0785 m=7.85 cm\lambda = \frac{2\pi}{k} = \frac{2\pi}{80.0 \text{ m}^{-1}} \approx 0.0785 \text{ m} = 7.85 \text{ cm}


(c) Period and Frequency First, calculate the period using the angular frequency: T=2πω=2π3.0 s12.09 sT = \frac{2\pi}{\omega} = \frac{2\pi}{3.0 \text{ s}^{-1}} \approx 2.09 \text{ s} Next, calculate the frequency: ν=1T=12.09 s0.48 Hz\nu = \frac{1}{T} = \frac{1}{2.09 \text{ s}} \approx 0.48 \text{ Hz}


(d) Displacement at x=0.3 mx = 0.3 \text{ m} and t=20 st = 20 \text{ s} Substitute the values of xx and tt into the wave equation: y=(0.005 m)sin(80.0×0.33.0×20)y = (0.005 \text{ m}) \sin(80.0 \times 0.3 - 3.0 \times 20) y=(0.005 m)sin(2460)y = (0.005 \text{ m}) \sin(24 - 60) y=(0.005 m)sin(36)y = (0.005 \text{ m}) \sin(-36) The argument of the sine function is in radians. We can simplify this by noting that sin(θ)=sin(θ+2nπ)\sin(\theta) = \sin(\theta + 2n\pi). Let's find an equivalent angle in a more familiar range. 12π37.69912\pi \approx 37.699. sin(36)=sin(36+12π)sin(1.699 rad)\sin(-36) = \sin(-36 + 12\pi) \approx \sin(1.699 \text{ rad}) Converting radians to degrees: 1.699 rad×180π971.699 \text{ rad} \times \frac{180^\circ}{\pi} \approx 97^\circ. y(0.005 m)sin(97)0.005 m×0.99250.00496 my \approx (0.005 \text{ m}) \sin(97^\circ) \approx 0.005 \text{ m} \times 0.9925 \approx 0.00496 \text{ m}

Final Answer (a) Amplitude is 5 mm5 \text{ mm}. (b) Wavelength is 7.85 cm7.85 \text{ cm}. (c) Period is 2.09 s2.09 \text{ s} and frequency is 0.48 Hz0.48 \text{ Hz}. (d) The displacement is approximately 5 mm5 \text{ mm}.

The Speed of a Travelling Wave

The speed of a wave is the speed at which the disturbance propagates through the medium. We can determine this by tracking a point of constant phase, such as a crest.

For a point of constant phase, the term (kxωt)(kx - \omega t) must be constant. kxωt=constantkx - \omega t = \text{constant} If we differentiate this with respect to time, we get: kdxdtω=0k \frac{dx}{dt} - \omega = 0 Since dxdt\frac{dx}{dt} is the speed of the wave, vv, we have: v=dxdt=ωkv = \frac{dx}{dt} = \frac{\omega}{k}

We can express this in terms of wavelength and frequency. Since ω=2πν\omega = 2\pi\nu and k=2π/λk = 2\pi/\lambda: v=2πν2π/λ=λνv = \frac{2\pi\nu}{2\pi/\lambda} = \lambda\nu This gives us the fundamental wave speed relation: v=λν=λTv = \lambda \nu = \frac{\lambda}{T}

This equation shows that in one period (TT), the wave travels a distance equal to one wavelength (λ\lambda).

Note
The speed of a mechanical wave is determined by the properties of the medium it travels through, specifically its elastic properties (how quickly particles return to equilibrium) and its inertial properties (how much they resist changes in motion).

Speed of a Transverse Wave on a Stretched String

For a transverse wave on a string, the speed depends on two factors:

  1. Tension (TT): The restoring force that pulls the string back to its straight form. Higher tension means a faster wave.
  2. Linear Mass Density (μ\mu): The mass per unit length of the string (m/Lm/L). This is the inertial property. A heavier string (higher μ\mu) means a slower wave.

The formula for the speed of a transverse wave on a string is: v=Tμv = \sqrt{\frac{T}{\mu}}

Example
A steel wire 0.72 m long has a mass of 5.0×103 kg5.0 \times 10^{-3} \text{ kg}. If the wire is under a tension of 60 N, what is the speed of transverse waves on the wire?

Given

  • Length, L=0.72 mL = 0.72 \text{ m}
  • Mass, m=5.0×103 kgm = 5.0 \times 10^{-3} \text{ kg}
  • Tension, T=60 NT = 60 \text{ N}

To Find

Speed of the wave, vv

Formula

v=Tμv = \sqrt{\frac{T}{\mu}} where μ=m/L\mu = m/L

Solution

First, calculate the linear mass density, μ\mu: μ=5.0×103 kg0.72 m6.9×103 kg m1\mu = \frac{5.0 \times 10^{-3} \text{ kg}}{0.72 \text{ m}} \approx 6.9 \times 10^{-3} \text{ kg m}^{-1}

Now, substitute the values of TT and μ\mu into the speed formula: v=60 N6.9×103 kg m18695.6593 m s1v = \sqrt{\frac{60 \text{ N}}{6.9 \times 10^{-3} \text{ kg m}^{-1}}} \approx \sqrt{8695.65} \approx 93 \text{ m s}^{-1}

Final Answer The speed of transverse waves on the wire is approximately 93 m s193 \text{ m s}^{-1}.

Speed of a Longitudinal Wave (Speed of Sound)

For a longitudinal wave, like sound, the speed depends on:

  1. Bulk Modulus (BB): The elastic property. It measures how resistant a substance is to compression. A higher bulk modulus (harder to compress) means a faster wave.
  2. Density (ρ\rho): The mass per unit volume. This is the inertial property. Higher density means a slower wave.

The general formula for the speed of a longitudinal wave in a fluid is: v=Bρv = \sqrt{\frac{B}{\rho}}

For a solid bar, the relevant elastic property is the Young's Modulus (YY): v=Yρv = \sqrt{\frac{Y}{\rho}}

Sound travels faster in solids and liquids than in gases because their bulk modulus values are much higher, which more than compensates for their greater densities.

Speed of Sound in a Gas: Newton's Formula and Laplace's Correction

Newton's Formula Isaac Newton first derived a formula for the speed of sound in a gas. He assumed that the compressions and rarefactions caused by a sound wave occur slowly enough for the process to be isothermal (constant temperature). For an ideal gas under isothermal conditions, the bulk modulus is equal to the pressure (B=PB = P). This led to Newton's formula: v=Pρv = \sqrt{\frac{P}{\rho}} However, this formula gives a value for the speed of sound in air that is about 15% lower than the experimental value.

Laplace's Correction Pierre-Simon Laplace corrected Newton's assumption. He pointed out that the compressions and rarefactions happen so quickly that there is no time for heat to flow between them. The process is adiabatic (no heat exchange), not isothermal.

For an adiabatic process in an ideal gas, the bulk modulus is given by Bad=γPB_{ad} = \gamma P, where γ\gamma (gamma) is the ratio of specific heats (Cp/CvC_p/C_v). This leads to the corrected formula, known as the Laplace formula: v=γPρv = \sqrt{\frac{\gamma P}{\rho}} For air, γ1.4\gamma \approx 1.4 (or 7/57/5), and this formula gives a value for the speed of sound that agrees very well with experimental results.

Example
Estimate the speed of sound in air at standard temperature and pressure (STP). The mass of 1 mole of air is 29.0×103 kg29.0 \times 10^{-3} \text{ kg}.

Given

  • At STP, Pressure P=1.01×105 N m2P = 1.01 \times 10^5 \text{ N m}^{-2}
  • Mass of one mole of air = 29.0×103 kg29.0 \times 10^{-3} \text{ kg}
  • Volume of one mole of gas at STP = 22.4 litres=22.4×103 m322.4 \text{ litres} = 22.4 \times 10^{-3} \text{ m}^3

To Find

Speed of sound in air, vv, using Newton's formula.

Formula

v=Pρv = \sqrt{\frac{P}{\rho}}

Solution

First, calculate the density of air at STP: ρo=mass of one molevolume of one mole=29.0×103 kg22.4×103 m31.29 kg m3\rho_o = \frac{\text{mass of one mole}}{\text{volume of one mole}} = \frac{29.0 \times 10^{-3} \text{ kg}}{22.4 \times 10^{-3} \text{ m}^3} \approx 1.29 \text{ kg m}^{-3}

Now, use Newton's formula: v=1.01×105 N m21.29 kg m378294280 m s1v = \sqrt{\frac{1.01 \times 10^5 \text{ N m}^{-2}}{1.29 \text{ kg m}^{-3}}} \approx \sqrt{78294} \approx 280 \text{ m s}^{-1}

Final Answer Newton's formula estimates the speed of sound in air at STP to be 280 m s1280 \text{ m s}^{-1}. (Using Laplace's correction with γ=1.4\gamma = 1.4, the calculated speed is v=1.4×280331.3 m s1v = \sqrt{1.4} \times 280 \approx 331.3 \text{ m s}^{-1}, which is very close to the measured value of 331 m s1331 \text{ m s}^{-1}).

The Principle of Superposition of Waves

What happens when two or more waves meet at the same point in a medium? The Principle of Superposition states that the resultant displacement of a particle is the algebraic sum of the displacements that each individual wave would have caused. y(x,t)=y1(x,t)+y2(x,t)+y(x, t) = y_1(x, t) + y_2(x, t) + \dots After passing through each other, the waves continue on their way unchanged.

This principle leads to the phenomenon of interference. Let's consider two harmonic waves travelling in the same direction with the same amplitude (aa), angular frequency (ω\omega), and wave number (kk), but with a phase difference of ϕ\phi. y1(x,t)=asin(kxωt)y_1(x, t) = a \sin(kx - \omega t) y2(x,t)=asin(kxωt+ϕ)y_2(x, t) = a \sin(kx - \omega t + \phi)

Using the principle of superposition, the resultant displacement is: y(x,t)=y1+y2=a[sin(kxωt)+sin(kxωt+ϕ)]y(x, t) = y_1 + y_2 = a[\sin(kx - \omega t) + \sin(kx - \omega t + \phi)] Using the trigonometric identity sinA+sinB=2sin(A+B2)cos(AB2)\sin A + \sin B = 2 \sin\left(\frac{A+B}{2}\right)\cos\left(\frac{A-B}{2}\right), we get: y(x,t)=(2acosϕ2)sin(kxωt+ϕ2)y(x, t) = \left(2a \cos \frac{\phi}{2}\right) \sin\left(kx - \omega t + \frac{\phi}{2}\right) This resultant wave has the same frequency and wavelength, but its amplitude, A=2acos(ϕ/2)A = 2a \cos(\phi/2), depends on the phase difference ϕ\phi.

  • Constructive Interference: Occurs when the waves are in phase (ϕ=0,2π,4π,\phi = 0, 2\pi, 4\pi, \dots). Here, cos(ϕ/2)=1\cos(\phi/2) = 1, and the resultant amplitude is maximum, A=2aA = 2a. The waves add up.
  • Destructive Interference: Occurs when the waves are out of phase (ϕ=π,3π,5π,\phi = \pi, 3\pi, 5\pi, \dots). Here, cos(ϕ/2)=0\cos(\phi/2) = 0, and the resultant amplitude is zero, A=0A = 0. The waves cancel each other out.

Reflection of Waves

When a travelling wave encounters a boundary, it can be reflected. The nature of the reflection depends on the type of boundary.

Reflection at a Rigid Boundary

When a wave on a string hits a fixed end (like a wall), it reflects back. The reflected wave is inverted. This corresponds to a phase change of π\pi (or 180°).

  • If the incident wave is yi(x,t)=asin(kxωt)y_i(x, t) = a \sin(kx - \omega t),
  • The reflected wave travelling in the opposite direction is yr(x,t)=asin(kx+ωt+π)=asin(kx+ωt)y_r(x, t) = a \sin(kx + \omega t + \pi) = -a \sin(kx + \omega t).

This happens because at a rigid boundary, the displacement must always be zero. By the principle of superposition, the incident and reflected waves must cancel each other out at the boundary at all times.

Reflection at an Open Boundary

When a wave on a string hits a free end (like a ring that can slide frictionlessly on a rod), it reflects back without being inverted. There is no phase change upon reflection.

  • If the incident wave is yi(x,t)=asin(kxωt)y_i(x, t) = a \sin(kx - \omega t),
  • The reflected wave is yr(x,t)=asin(kx+ωt)y_r(x, t) = a \sin(kx + \omega t).

Standing Waves and Normal Modes

When two identical waves travelling in opposite directions interfere, they can create a standing wave or stationary wave. This often happens when a wave is reflected from a boundary and interferes with the incoming wave.

Consider two waves:

  • Incident wave: y1(x,t)=asin(kxωt)y_1(x, t) = a \sin(kx - \omega t)
  • Reflected wave: y2(x,t)=asin(kx+ωt)y_2(x, t) = a \sin(kx + \omega t)

The superposition gives: y(x,t)=y1+y2=a[sin(kxωt)+sin(kx+ωt)]y(x, t) = y_1 + y_2 = a[\sin(kx - \omega t) + \sin(kx + \omega t)] Using a trigonometric identity, this simplifies to: y(x,t)=[2asin(kx)]cos(ωt)y(x, t) = [2a \sin(kx)] \cos(\omega t)

This is the equation for a standing wave. Notice two key features:

  1. The wave pattern does not travel; it oscillates in place.
  2. The amplitude of oscillation, [2asin(kx)][2a \sin(kx)], is not constant but depends on the position xx.

Nodes and Antinodes

  • Nodes are points on the standing wave that have zero amplitude and remain stationary at all times. They occur where sin(kx)=0\sin(kx) = 0, which means kx=nπkx = n\pi for n=0,1,2,n = 0, 1, 2, \dots. The distance between two consecutive nodes is λ/2\lambda/2.
  • Antinodes are points that have the maximum possible amplitude (2a2a). They occur where sin(kx)=1|\sin(kx)| = 1, which means kx=(n+1/2)πkx = (n + 1/2)\pi. The distance between two consecutive antinodes is also λ/2\lambda/2.

Normal Modes of a Stretched String

For a string of length LL fixed at both ends (x=0x=0 and x=Lx=L), the ends must be nodes. This condition restricts the possible wavelengths and frequencies of the standing waves that can exist on the string. The condition for the far end to be a node is L=n(λ/2)L = n(\lambda/2), where n=1,2,3,n=1, 2, 3, \dots.

This means the allowed wavelengths are: λn=2Ln\lambda_n = \frac{2L}{n} The corresponding allowed frequencies, called the normal modes or harmonics, are: νn=vλn=nv2L(n=1,2,3,)\nu_n = \frac{v}{\lambda_n} = \frac{nv}{2L} \quad (n=1, 2, 3, \dots)

  • n=1n=1: Fundamental frequency or first harmonic. This is the lowest possible frequency.
  • n=2n=2: Second harmonic (or first overtone).
  • n=3n=3: Third harmonic (or second overtone), and so on.

Normal Modes of an Air Column

Standing waves can also be set up in air columns, such as in organ pipes or flutes. The boundary conditions are different:

  • A closed end of a pipe is a displacement node.
  • An open end of a pipe is a displacement antinode.

1. Pipe Closed at One End, Open at the Other Let the length of the pipe be LL. There is a node at the closed end (x=0x=0) and an antinode at the open end (x=Lx=L). This requires that the length of the pipe be an odd multiple of a quarter-wavelength: L=(n+1/2)(λ/2)L = (n + 1/2)(\lambda/2) for n=0,1,2,n=0, 1, 2, \dots.

The allowed frequencies are: νn=(n+1/2)v2L=(2n+1)v4L(n=0,1,2,)\nu_n = (n + 1/2)\frac{v}{2L} = (2n+1)\frac{v}{4L} \quad (n=0, 1, 2, \dots)

  • The fundamental frequency (n=0n=0) is ν0=v/4L\nu_0 = v/4L.
  • Only odd harmonics (v/4L,3v/4L,5v/4L,v/4L, 3v/4L, 5v/4L, \dots) are present.

2. Pipe Open at Both Ends There is an antinode at both ends. This requires the length of the pipe to be an integer multiple of a half-wavelength: L=n(λ/2)L = n(\lambda/2).

The allowed frequencies are: νn=nv2L(n=1,2,3,)\nu_n = \frac{nv}{2L} \quad (n=1, 2, 3, \dots)

  • All harmonics are present, just like on a string fixed at both ends.
Example
A pipe, 30.0 cm long, is open at both ends. Which harmonic mode of the pipe resonates a 1.1 kHz source? Will resonance with the same source be observed if one end of the pipe is closed? Take the speed of sound in air as 330 m s1330 \text{ m s}^{-1}.

Given

  • Length of pipe, L=30.0 cm=0.3 mL = 30.0 \text{ cm} = 0.3 \text{ m}
  • Source frequency, νsource=1.1 kHz=1100 Hz\nu_{source} = 1.1 \text{ kHz} = 1100 \text{ Hz}
  • Speed of sound, v=330 m s1v = 330 \text{ m s}^{-1}

To Find

(a) The harmonic mode n for an open pipe that resonates with the source. (b) Whether resonance will occur if one end is closed.

Formula

  • For an open pipe: νn=nv2L\nu_n = \frac{nv}{2L} for n=1,2,3,n=1, 2, 3, \dots
  • For a pipe closed at one end: νn=(2n+1)v4L\nu_n = (2n+1)\frac{v}{4L} for n=0,1,2,n=0, 1, 2, \dots

Solution

(a) Open Pipe The frequencies of the normal modes for the open pipe are: νn=n(330 m s1)2(0.3 m)=n×3300.6=550n Hz\nu_n = \frac{n(330 \text{ m s}^{-1})}{2(0.3 \text{ m})} = \frac{n \times 330}{0.6} = 550n \text{ Hz} We need to find an integer n for which νn=1100 Hz\nu_n = 1100 \text{ Hz}. 1100=550n1100 = 550n n=1100550=2n = \frac{1100}{550} = 2 Resonance occurs at the second harmonic.


(b) Pipe Closed at One End Now, let's find the possible resonant frequencies if one end is closed. The fundamental frequency is: ν0=v4L=330 m s14(0.3 m)=3301.2=275 Hz\nu_0 = \frac{v}{4L} = \frac{330 \text{ m s}^{-1}}{4(0.3 \text{ m})} = \frac{330}{1.2} = 275 \text{ Hz} Only odd multiples of this fundamental frequency are possible modes:

  • 1st harmonic (n=0n=0): 1×275=275 Hz1 \times 275 = 275 \text{ Hz}
  • 3rd harmonic (n=1n=1): 3×275=825 Hz3 \times 275 = 825 \text{ Hz}
  • 5th harmonic (n=2n=2): 5×275=1375 Hz5 \times 275 = 1375 \text{ Hz} The source frequency of 1100 Hz1100 \text{ Hz} is not an odd multiple of the fundamental frequency (1100/275=41100/275 = 4, which is an even number). Therefore, it does not correspond to a possible mode for the closed pipe.

Final Answer (a) The 1.1 kHz source will resonate with the second harmonic of the open pipe. (b) No resonance will be observed with the same source if one end of the pipe is closed.

Beats

Beats are the periodic and repeating fluctuations in the loudness of a sound that occur when two sound waves of very similar (but not identical) frequencies interfere with each other. The loudness of the sound waxes and wanes.

This phenomenon is a direct result of superposition. Consider two sound waves with equal amplitude a and slightly different angular frequencies ω1\omega_1 and ω2\omega_2. At a fixed point (x=0x=0), their displacements are: s1=acos(ω1t)s_1 = a \cos(\omega_1 t) s2=acos(ω2t)s_2 = a \cos(\omega_2 t) The resultant displacement is: s=s1+s2=a(cos(ω1t)+cos(ω2t))s = s_1 + s_2 = a(\cos(\omega_1 t) + \cos(\omega_2 t)) Using a trigonometric identity, this becomes: s=[2acos(ω1ω22t)]cos(ω1+ω22t)s = \left[2a \cos\left(\frac{\omega_1 - \omega_2}{2}t\right)\right] \cos\left(\frac{\omega_1 + \omega_2}{2}t\right) This can be interpreted as a wave oscillating rapidly at the average frequency, ωa=(ω1+ω2)/2\omega_a = (\omega_1 + \omega_2)/2, but with a slowly varying amplitude given by the term in the brackets.

The loudness is maximum when the amplitude term is maximum, which occurs twice in each cycle of the cosine function. The frequency of this amplitude variation (the beat) is twice the frequency of the amplitude term, ωb=(ω1ω2)/2\omega_b = (\omega_1 - \omega_2)/2. The angular frequency of the beats is 2ωb=ω1ω22\omega_b = \omega_1 - \omega_2.

The beat frequency, νbeat\nu_{beat}, is the difference between the two original frequencies: νbeat=ν1ν2\nu_{beat} = |\nu_1 - \nu_2|

Example
Musicians use beats to tune their instruments. If two instruments are playing slightly different notes, a pulsating beat is heard. The musician adjusts one instrument until the beats disappear, meaning the frequencies are identical.
Example
Two sitar strings A and B playing the note 'Dha' are slightly out of tune and produce beats of frequency 5 Hz. The tension of the string B is slightly increased and the beat frequency is found to decrease to 3 Hz. What is the original frequency of B if the frequency of A is 427 Hz?

Given

  • Frequency of string A, νA=427 Hz\nu_A = 427 \text{ Hz}
  • Initial beat frequency, νAνB=5 Hz|\nu_A - \nu_B| = 5 \text{ Hz}
  • Final beat frequency (after increasing tension in B) = 3 Hz

To Find

The original frequency of string B, νB\nu_B.

Formula

  • Beat frequency: νbeat=ν1ν2\nu_{beat} = |\nu_1 - \nu_2|
  • Wave speed on a string: v=T/μv = \sqrt{T/\mu}
  • Frequency of a string: νvT\nu \propto v \propto \sqrt{T}

Solution

From the initial condition, we have two possibilities for the original frequency of B:

  1. νAνB=5    νB=4275=422 Hz\nu_A - \nu_B = 5 \implies \nu_B = 427 - 5 = 422 \text{ Hz}
  2. νBνA=5    νB=427+5=432 Hz\nu_B - \nu_A = 5 \implies \nu_B = 427 + 5 = 432 \text{ Hz}

Now, consider the effect of increasing the tension in string B. Increasing the tension increases the wave speed on the string, which in turn increases its frequency (νT\nu \propto \sqrt{T}). So, νB\nu_B increases.

Let's test both possibilities:

  • Case 1: Original νB=422 Hz\nu_B = 422 \text{ Hz}. When tension is increased, νB\nu_B increases, getting closer to νA\nu_A (427 Hz). This would cause the difference νAνB|\nu_A - \nu_B| (the beat frequency) to decrease. This matches the observation that the beat frequency decreased from 5 Hz to 3 Hz.
  • Case 2: Original νB=432 Hz\nu_B = 432 \text{ Hz}. When tension is increased, νB\nu_B increases further, moving away from νA\nu_A (427 Hz). This would cause the difference νAνB|\nu_A - \nu_B| to increase. This contradicts the observation.

Therefore, the first case must be correct.

Final Answer The original frequency of string B is 422 Hz422 \text{ Hz}.

Congratulations! You've completed this chapter

Great job reading through all sections. Ready to test your knowledge and reinforce your learning?